This compound is a sodium salt form of a phenothiazine derivative, used primarily as a research reagent. It features a tricyclic structure with dimethylamino substituents and an aminoacetate group, making it suitable for laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 115871-18-6
Sodium 2-(3,3-bis(4-(dimethylamino)phenyl)ureido)acetate
research compound
Pentanoic-d9 acid
stable isotopically labeled research compound
1,4-Di(hydroxymethyl)benzene-d4
deuterated reference standard
L-Aspartic acid, L-tyrosyl-D-alanylglycyl-L-phenylalanyl-L-leucyl-
research compound
Promethazine-d4 (hydrochloride)
deuterated pharmaceutical reference standard
1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]ethanone;(Z)-but-2-enedioic acid
deuterated reference standard
Promethazine teoclate
active pharmaceutical ingredient
2-Methoxyphenothiazine
research compound
sodium 2-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]acetate
CWLYDTVACYGEPD-UHFFFAOYSA-M
CN(C)C1=CC2=C(C=C1)N(C3=C(S2)C=C(C=C3)N(C)C)C(=O)NCC(=O)[O-].[Na+]
—