This compound is a pharmaceutical intermediate featuring a biphenyl core with a bromomethyl substituent and a tert-butyl ester group. It is primarily relevant in the synthesis of advanced pharmaceutical compounds, particularly those targeting the angiotensin II receptor.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 114772-40-6
2-Cyano-4'-methylbiphenyl
pharmaceutical intermediate
4'-Bromomethyl-2-cyanobiphenyl
Pharmaceutical intermediate
Des[2'-(1H-tetrazol-5-yl)] 2-cyanolosartan
Pharmaceutical intermediate for losartan synthesis
2-Chloro-4-fluoro-5-nitrobenzoic acid
pharmaceutical intermediate for bumetanide
tert-butyl 2-[4-(bromomethyl)phenyl]benzoate
YHXCWNQNVMAENQ-UHFFFAOYSA-N
CC(C)(C)OC(=O)C1=CC=CC=C1C2=CC=C(C=C2)CBr