This compound is a deuterium-labeled research reagent, specifically a bromoiodobenzene derivative with four deuterium atoms replacing hydrogen atoms on the aromatic ring. Its primary significance is as a stable isotope-labeled compound used in analytical and synthetic chemistry research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Benzene-1,2,4,5-d4, 3-bromo-6-iodo- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(R)-O-((2,2-Dimethyl-1,3-dioxolan-4-yl)methyl)hydroxylamine
organic synthesis intermediate
4,4,5,5-Tetramethyl-2-(3,3,3-trifluoropropyl)-1,3,2-dioxaborolane
Research reagent for synthetic chemistry
Diethyl 1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate
Hantzsch ester as redox probe
N-Carbobenzyloxy-L-valine
peptide synthesis reagent
1-Bromo-4-iodobenzene
research reagent for organic synthesis
1-bromo-2,3,5,6-tetradeuterio-4-iodobenzene
UCCUXODGPMAHRL-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1Br)[2H])[2H])I)[2H]
Benzene-1,2,4,5-d4, 3-bromo-6-iodo- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.