This compound is a research reagent featuring a complex structure with a pyrrolopyrimidine core and a tert-butyl carbamate protecting group. It is primarily used as a pharmaceutical research compound in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1143534-12-6
(1R,2S)-2-(3,4-difluorophenyl)cyclopropan-1-amine;hydrochloride
pharmaceutical research compound
(R)-N-(4-(chlorodifluoromethoxy)phenyl)-6-(3-hydroxypyrrolidin-1-yl)-5-(1-((2-(trimethylsilyl)ethoxy)methyl)-1H-pyrazol-5-yl)nicotinamide
pharmaceutical research compound
Loratadine N-Oxide
pharmaceutical research compound
(1S,3aR,4S,7aS)-1-((S)-1-(3-hydroxy-3-methylbutoxy)ethyl)-7a-methyloctahydro-1H-inden-4-ol
pharmaceutical research compound
1-(4-chlorophenyl)-3-methoxypropan-1-amine
research compound
Potassium Tris(trifluoromethanesulfonyl)methanide
research reagent
Ethyl N-benzyloxycarbonyl-2-glycinate
research compound for peptide synthesis
Galanin (mouse, rat)
neuropeptide research reagent
tert-butyl N-[4-[[(1S)-1-(4-chlorophenyl)-3-hydroxypropyl]carbamoyl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]carbamate
QIGUQECRLHBCDL-FQEVSTJZSA-N
CC(C)(C)OC(=O)NC1(CCN(CC1)C2=NC=NC3=C2C=CN3)C(=O)N[C@@H](CCO)C4=CC=C(C=C4)Cl
—