2,3,6-Trifluorophenylacetic acid is a fluorinated aromatic carboxylic acid used as a pharmaceutical intermediate. It features a benzene ring substituted with three fluorine atoms and an acetic acid side chain.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,3,6-Trifluorophenylacetic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl 2-chloro-3-oxopentanoate
pharmaceutical intermediate
Cbz-alanine
peptide synthesis intermediate
6-Bromo-2,3-dimethyl-2H-indazole
pharmaceutical intermediate
((4-METHOXYPHENYL){2-OXO-2-[(PYRIDIN-3-YLMETHYL)-AMINO]ETHYL}AMINO)ACETIC ACID
pharmaceutical intermediate
2-(2,3,6-trifluorophenyl)acetic acid
QRAZASHLGLHKEB-UHFFFAOYSA-N
C1=CC(=C(C(=C1F)CC(=O)O)F)F
2,3,6-Trifluorophenylacetic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.