This compound is a dye or pigment intermediate with a polycyclic structure containing an amine group and multiple aromatic rings. Its primary significance lies in its use as a precursor in the synthesis of colorants.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 113869-04-8
6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one
UKPIALJRUISJAX-UHFFFAOYSA-N
CC1=CC(=O)OC2=C3C4=C(C=C12)C(CCN4CCC3(C)C)(C)C
—