N-Benzyloxycarbonylglycine is a chemical compound used as a protecting group reagent in peptide synthesis. It is also the substrate for the enzyme N-benzyloxycarbonylglycine hydrolase, which cleaves it into benzyl alcohol, carbon dioxide, and glycine.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1138-80-3
Benzyl carbamoylmethylcarbamate
Research reagent for peptide synthesis
Methyl N-benzyloxycarbonylglycinate
protected amino acid intermediate
2-Chlorotrityl chloride
Protecting group reagent for peptide synthesis
(2R)-(-)-Glycidyl tosylate
Pharmaceutical intermediate for chiral synthesis
4-ACETYL-2-METHYLBENZONITRILE
Pharmaceutical intermediate
4,7-Dichloroquinoline
Chemical intermediate for antimalarial drugs
N4-Acetyl-2'-O-methylcytidine
modified nucleoside intermediate
2-(phenylmethoxycarbonylamino)acetic acid
CJUMAFVKTCBCJK-UHFFFAOYSA-N
C1=CC=C(C=C1)COC(=O)NCC(=O)O