This compound is a derivative of the amino acid lysine, modified with two carboxymethyl groups that enable it to bind metal ions. It is primarily used as an analytical chelating agent in research and laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(5S)-N-(5-Amino-1-carboxypentyl)iminodiacetic Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,6-bis(N-pyrazolyl)pyridine nickel(II) bromide
research compound
1-Cyano-3-nitrosoguanidine
nitrosamine reference standard
N-(6-BROMONAPHTHALEN-2-YL)METHANESULFONAMIDE
research compound
N-(6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)NAPHTHALEN-2-YL)METHANESULFONAMIDE
boronic acid pinacol ester research compound
(2S)-6-amino-2-[bis(carboxymethyl)amino]hexanoic acid
SYFQYGMJENQVQT-ZETCQYMHSA-N
C(CCN)C[C@@H](C(=O)O)N(CC(=O)O)CC(=O)O
(5S)-N-(5-Amino-1-carboxypentyl)iminodiacetic Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.