Oleoyl chloride is a chemical compound used primarily as a pharmaceutical intermediate in the synthesis of other compounds. It is an acyl chloride derived from oleic acid, characterized by a long hydrocarbon chain and a reactive chlorocarbonyl group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 112-77-6
Nonanoyl chloride
Acylating agent for chemical synthesis
(2R)-2-(((2R)-1-(Bis(4-methoxyphenyl)(phenyl)methoxy)-3-(((2-cyanoethoxy)(diisopropylamino)phosphino)oxy)propan-2-yl)oxy)-2-(2-isobutyramido-6-oxo-3H-purin-9(6H)-yl)ethyl benzoate
nucleoside phosphoramidite building block
(S)-tetrahydrofuran-3-yl 4-methylbenzenesulfonate
Chiral intermediate for pharmaceutical synthesis
(S)-(-)-alpha,alpha-Diphenyl-2-pyrrolidinemethanol
pharmaceutical intermediate
4-methylpyridin-3-ol
Pharmaceutical intermediate
(Z)-octadec-9-enoyl chloride
MLQBTMWHIOYKKC-KTKRTIGZSA-N
CCCCCCCC/C=C\CCCCCCCC(=O)Cl