4-Hydroxyphenobarbital-d5 is a deuterated analytical reference standard, featuring five deuterium atoms in its ethyl side chain. It is primarily used as an internal standard in mass spectrometry and analytical chemistry for the quantification of phenobarbital metabolites.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Hydroxyphenobarbital-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Methyl-d3-indole
deuterated research compound
Ethyl alaninate hydrochloride
research compound for amino acid studies
N-Acetyl-DL-alanine
N-acyl-amino acid reference standard
2-Aminoheptanoic acid
research compound
Mephobarbital
anticonvulsant active pharmaceutical ingredient
페노바르비탈
Anticonvulsant and sedative active ingredient
Phenylmethylbarbituric acid
active pharmaceutical ingredient
5-(4-hydroxyphenyl)-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione
IEPXMKJNWPXDBP-ZBJDZAJPSA-N
[2H]C([2H])([2H])C([2H])([2H])C1(C(=O)NC(=O)NC1=O)C2=CC=C(C=C2)O
4-Hydroxyphenobarbital-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.