This compound is a protected amino acid derivative used in peptide synthesis. Its significance lies in the orthogonal protection of the histidine side chain, enabling selective incorporation of histidine into synthetic peptides.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 109425-51-6
Fmoc-His(Trt)-Gly-OH
Peptide synthesis building block
(S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-trityl-1H-imidazol-4-yl)propanamido)-2-methylpropanoic acid
Research compound for peptide synthesis
Tert-butyl (3R)-3-hydroxypyrrolidine-1-carboxylate
Pharmaceutical intermediate for API synthesis
Methyl 5-(chlorosulfonyl)-2-fluorobenzoate
Pharmaceutical intermediate
Sildenafil N-Oxide
pharmaceutical impurity reference standard
Zolpidem 6-Carboxylic Acid
impurity reference standard for zolpidem
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-[1-(triphenylmethyl)-1H-imidazol-4-yl]propanoic acid
Protected amino acid for peptide synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoic acid
XXMYDXUIZKNHDT-QNGWXLTQSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)C[C@@H](C(=O)O)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57