Alpha-Terthienyl is a synthetic polymer MALDI matrix compound used primarily in analytical chemistry for matrix-assisted laser desorption/ionization mass spectrometry. Its significance lies in its ability to facilitate the ionization of synthetic polymers for molecular weight determination.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Alpha-Terthienyl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,2'-Bithiophene
organic electronic material
5-Formylsalicylic acid
synthetic polymer MALDI matrix compound
Methyl 6-methyl-2,4-bis(2-nitrophenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate
research reagent
3-iodo-1h-pyrazolo[3,4-c]pyridine
research compound
5-bromo-4-fluoro-1H-indazole
research compound
D-Asparagine methyl ester
research compound
2,5-dithiophen-2-ylthiophene
KXSFECAJUBPPFE-UHFFFAOYSA-N
C1=CSC(=C1)C2=CC=C(S2)C3=CC=CS3
Alpha-Terthienyl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.