2,4-Dimethyl-5-nitropyridine is a research compound with a pyridine ring framework substituted with methyl and nitro groups. It is primarily used as a laboratory reagent for chemical synthesis and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1074-99-3
4-(6-Methoxynaphthalen-2-yl)benzoic acid
pharmaceutical impurity reference standard
4-Vinylbenzoic acid
Building block for polymer synthesis
3-bromobenzylmagnesium bromide
Grignard reagent for organic synthesis
4-Ethylphenylboronic acid pinacol ester
Boronic acid ester for Suzuki coupling
2,4-dimethyl-5-nitropyridine
GMAJNANLBOHCAU-UHFFFAOYSA-N
CC1=CC(=NC=C1[N+](=O)[O-])C