Granisetron Impurity B is a chemical compound used as a pharmaceutical intermediate. It is primarily employed in the manufacturing of granisetron-related products.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 107007-95-4
Tert-butyl N-[1-(hydroxymethyl)cyclopropyl]carbamate
peptide synthesis protecting group intermediate
(s)-azetidine-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester
Pharmaceutical intermediate for peptide synthesis
4-[[6-chloro-2-[(4-cyanophenyl)amino]-4-pyrimidinyl]oxy]-3,5-dimethylbenzonitrile
Pharmaceutical intermediate for impurity synthesis
Cyclopropanamine, 2-(phenyl-d5)-, hydrochloride, trans-
deuterated pharmaceutical reference standard
BRL 43694A
Pharmaceutical active ingredient
N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-1H-indazole-3-carboxamide
GHVQAOGYNZNTIA-UHFFFAOYSA-N
CN1C2CCCC1CC(C2)NC(=O)C3=NNC4=CC=CC=C43