Sodium bis(trimethylsilyl)amide is a strong base commonly used in chemical synthesis as a laboratory reagent. It is a salt-like compound composed of a sodium cation and a bis(trimethylsilyl)amide anion, typically handled under inert conditions due to its reactivity with moisture.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1070-89-9
Potassium bis(trimethylsilyl)amide
strong non-nucleophilic base
BrettPhos
phosphine ligand for cross-coupling reactions
2,5-Dimethoxyphenylboronic acid
Research reagent for organic synthesis
S-Ethylisothiourea hydrobromide
Research compound for chemical synthesis
5-bromo-3,4-dimethylbenzene-1,2-diamine
research compound
sodium bis(trimethylsilyl)azanide
WRIKHQLVHPKCJU-UHFFFAOYSA-N
C[Si](C)(C)[N-][Si](C)(C)C.[Na+]