Z-Lys(Fmoc)-OH is a protected lysine derivative commonly used in solid-phase peptide synthesis. It features both a benzyloxycarbonyl (Cbz) protecting group on the alpha-amino group and a fluorenylmethyloxycarbonyl (Fmoc) protecting group on the lysine side chain, enabling selective deprotection strategies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Z-Lys(Fmoc)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2S)-6-{[(benzyloxy)carbonyl]amino}-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hexanoic acid
peptide synthesis protected amino acid
(2S)-2,6-bis({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Protected amino acid for peptide synthesis
Fmoc-Lys(Ac)-OH
Research compound for peptide synthesis
N2,N6-Bis[(phenylmethoxy)carbonyl]-L-lysine
Protected amino acid for peptide synthesis
N6-(tert-Butoxycarbonyl)-N2-((9H-fluoren-9-ylmethoxy)carbonyl)-L-lysine
Protected lysine derivative for peptide synthesis
4-Iodopyridin-3-amine
Pharmaceutical intermediate
Sodium 4-hydroxybenzenesulfonate dihydrate
Pharmaceutical intermediate
(3S,4R)-4-(4-Fluorophenyl)-1-methyl-3-piperidinemethanol
pharmaceutical intermediate
(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(phenylmethoxycarbonylamino)hexanoic acid
LNKKPRSYVVUBTR-SANMLTNESA-N
C1=CC=C(C=C1)COC(=O)N[C@@H](CCCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O
Z-Lys(Fmoc)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.