N-Nitroso Cilazapril is a chemical compound used as a nitrosamine impurity standard in pharmaceutical research and quality control. It is structurally related to the angiotensin-converting enzyme inhibitor cilazapril.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1053740-92-3
1,2-Dimyristoyl-sn-glycero-3-phospho-L-serine sodium salt
phospholipid research reagent
4-(Methylamino)benzoic acid
research reagent
PRO-LYS-LYS-LYS-ARG-LYS-VAL-GLU-ASP-*PRO-TYR-CYS
research compound
1-(4-Bromobenzyl)-3-hydroxyazetidine
research compound
(4S,7S)-7-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-nitrosoamino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylic acid
RJJSZSYJUSKBNU-FHWLQOOXSA-N
CCOC(=O)[C@H](CCC1=CC=CC=C1)N([C@H]2CCCN3CCC[C@H](N3C2=O)C(=O)O)N=O