4-Methoxymandelic acid is a chemical intermediate used in the production of vanillylmandelic acid. Vanillylmandelic acid is an intermediate in the synthesis of artificial vanilla flavorings and is also the end-stage metabolite of catecholamines.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 10502-44-0
Fmoc-L-lysine
Protected amino acid for peptide synthesis
2-Cyanoethyl 2-(4-cyano-2-methoxybenzylidene)-3-oxobutanoate
Pharmaceutical intermediate for finerenone
2-Cyanoethyl 4-(4-cyano-2-methoxyphenyl)-2,8-dimethyl-5-oxo-1,4,5,6-tetrahydro-1,6-naphthyridine-3-carboxylate
pharmaceutical intermediate
2-cyanoethyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate
pharmaceutical intermediate
D-4-Methoxymandelic acid
research compound
(2S)-2-hydroxy-2-(4-methoxyphenyl)acetic acid
research reference standard
2-hydroxy-2-(4-methoxyphenyl)acetic acid
ITECRQOOEQWFPE-UHFFFAOYSA-N
COC1=CC=C(C=C1)C(C(=O)O)O