Nonanedioic acid, 1,9-bis(2-methylpropyl) ester is an industrial chemical used primarily as a plasticizer and lubricant intermediate. Its structure consists of a nine-carbon dicarboxylic acid chain esterified with two 2-methylpropyl groups, providing low polarity and flexibility.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 105-80-6
Dimethyl dodecanedioate
plasticizer and lubricant intermediate
1,1-Dipropoxyethane
Chemical intermediate
Potassium trimethylsilanolate
Waterproofing agent
N-Ethyl-N,N-dimethylcyclohexanaminium hydroxide
structure directing agent
4-Butylbenzyl Bromide
chemical intermediate for synthesis
bis(2-methylpropyl) nonanedioate
KEVDDQOYWPSMFD-UHFFFAOYSA-N
CC(C)COC(=O)CCCCCCCC(=O)OCC(C)C