This compound is an Fmoc-protected amino acid building block used in pharmaceutical intermediate manufacturing. It features a complex structure with multiple functional groups including an acid, amide, and aromatic rings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Oxazolidinecarboxylic acid, 3-((2S)-2-(((9H-fluoren-9-ylmethoxy)carbonyl)amino)-1-oxo-3-phenylpropyl)-2,2,5-trimethyl-, (4S,5R)-
Fmoc-protected amino acid building block
Fmoc-acpc-oh
Fmoc-protected amino acid building block
2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(7-methyl-1H-indol-2-yl)propanoic acid
Fmoc-protected amino acid building block
Fmoc-Asp-OAll
Fmoc-protected amino acid building block
Ethyl 4-chloro-3-hydroxybutanoate
pharmaceutical intermediate
2,2-dimethyl-2,3-dihydro-1H-inden-1-one
pharmaceutical intermediate
Tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine-1-carboxylate
Boc-protected boronic ester intermediate
Methyl 3-bromo-4-methylbenzoate
Pharmaceutical intermediate
(2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-[[2-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonyl]hydrazinyl]methylideneamino]pentanoic acid
MGHQIUXLMQPDAM-PMERELPUSA-N
CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NNC=NCCC[C@@H](C(=O)O)NC(=O)CNC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.