4-Nitrophenylacetic acid is an organic compound used as a reagent in organic synthesis. It is a derivative of phenylacetic acid containing a nitro group and is employed in the formation of heterocycles.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Nitrophenylacetic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
BENZIL
organic synthesis reagent
Trimethylsulfonium iodide
organic synthesis reagent
Tosylmethyl isocyanide
organic synthesis reagent
Azidotrimethylsilane
organic synthesis reagent
2-Hydroxy-4-(trifluoromethyl)pyrimidine
research compound
3-Methoxynaphthalene-2-boronic acid
research compound
(2-methoxynaphthalen-1-yl)boronic Acid
pharmaceutical intermediate or research compound
N,O-Bis(trimethylsilyl)acetamide
silylating reagent for gas chromatography
4-Nitrophenylacetic acid(CAS 104-03-0)의 국제 HS 코드는 2916.39입니다.
2916.39
2916 39 90
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2-(4-nitrophenyl)acetic acid
YBADLXQNJCMBKR-UHFFFAOYSA-N
C1=CC(=CC=C1CC(=O)O)[N+](=O)[O-]
4-Nitrophenylacetic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.