2-Benzamido-4-mercaptobutanoic acid is a research compound featuring a benzamide group linked to a thiol-containing butanoic acid backbone. Its structure includes an amide, a carboxylic acid, and a thiol group, making it useful as a building block in peptide and intermediate synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-benzamido-4-mercaptobutanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Nitrosopiperidin-4-yl)diphenylmethanol
Nitrosamine impurity reference standard
4,4'-Diaminooctafluorobiphenyl
research compound for structural studies
4,4'-Dibromooctafluorobiphenyl
Research compound for crystallography studies
3-(3,4-dichlorophenyl)pentanedioic acid
research compound
2-benzamido-4-sulfanylbutanoic acid
ZQQSNOCMNFNYHN-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)NC(CCS)C(=O)O
2-benzamido-4-mercaptobutanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.