This compound is a deuterium-labeled derivative of 4-methoxytoluene, used primarily as a research reagent. Its deuterated structure makes it valuable for analytical studies such as mass spectrometry and NMR spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1036431-36-3
3-Methoxyphenylboronic acid
research compound
2-Chloronicotinamide
research compound
(1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-ol
research compound
2-(Trifluoromethyl)pyridine-4-boronic acid, pinacol ester
boronic ester research reagent
4-METHOXYTOLUENE-2,3,5,6-D4
isotope-labeled research standard
1,2,4,5-tetradeuterio-3-methoxy-6-(trideuteriomethyl)benzene
CHLICZRVGGXEOD-HRDWIZOWSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])OC)[2H]