Leupeptin hemisulfate is a peptide sulfate salt consisting of leupeptin with half an equivalent of sulfuric acid. It functions as a serine protease inhibitor and is used as a research reagent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 103476-89-7
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-methyl-D-leucine
Fmoc-protected amino acid for peptide synthesis
Quinoline-6-carboxylic acid
research compound
[4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride
catalyst for cross-coupling reactions
2-Bromothiazolo[5,4-c]pyridin-4(5H)-one
Research compound for chemical synthesis
bis((2S)-2-acetamido-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide);sulfuric acid
CIPMKIHUGVGQTG-VFFZMTJFSA-N
CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C=O)NC(=O)C.CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C=O)NC(=O)C.OS(=O)(=O)O