2-Aminoterephthalic acid is a research compound used primarily in materials science and chemistry. It features both carboxylic acid and amine functional groups on an aromatic ring, making it useful for synthesizing coordination polymers and other advanced materials.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Aminoterephthalic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl 1-benzylpiperidine-4-carboxylate
research compound
DL-Cysteine hydrochloride
research compound
(2,5-Dibromopyridin-4-yl)boronic acid
chemical synthesis intermediate
Phenobarbital N-?-D-Glucuronide
Pharmaceutical impurity reference standard
2-aminoterephthalic acid
GPNNOCMCNFXRAO-UHFFFAOYSA-N
C1=CC(=C(C=C1C(=O)O)N)C(=O)O
2-Aminoterephthalic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.