2-Aminoterephthalic acid is a research compound used primarily in materials science and chemistry. It features both carboxylic acid and amine functional groups on an aromatic ring, making it useful for synthesizing coordination polymers and other advanced materials.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 10312-55-7
Methyl 1-benzylpiperidine-4-carboxylate
research compound
DL-Cysteine hydrochloride
research compound
(2,5-Dibromopyridin-4-yl)boronic acid
chemical synthesis intermediate
Phenobarbital N-?-D-Glucuronide
Pharmaceutical impurity reference standard
2-aminoterephthalic acid
GPNNOCMCNFXRAO-UHFFFAOYSA-N
C1=CC(=C(C=C1C(=O)O)N)C(=O)O