2-Amino-6-chloropurine is a purine derivative used as a pharmaceutical intermediate, primarily in the synthesis of antiviral compounds. Its structure features an amino group and a chlorine substituent on the purine ring system, contributing to its utility in medicinal chemistry research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Amino-6-chloropurine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(S)-tert-butyl 6-(5-(7-broMo-9,9-difluoro-9H-fluoren-2-yl)-1H-iMidazol-2-yl)-5-azaspiro[2.4]heptane-5-carboxylate
Pharmaceutical intermediate for antiviral synthesis
1H-1,2,4-Triazole-1-carboximidamide hydrochloride
Pharmaceutical intermediate for antiviral synthesis
(2S,5S)-1-((S)-2-((Methoxycarbonyl)amino)-3-methylbutanoyl)-5-methylpyrrolidine-2-carboxylic acid
Pharmaceutical intermediate for antiviral synthesis
(2S)-2-Ethylbutyl 2-((chloro(phenoxy)phosphoryl)amino)propanoate
Pharmaceutical intermediate for antiviral synthesis
(3,4-Dimethoxyphenyl)acetyl chloride
Pharmaceutical intermediate for synthesis
1-Carbobenzoxy-4-piperidinecarboxylic Acid
Pharmaceutical intermediate for peptide synthesis
4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile
pharmaceutical intermediate
Citadiol hydrobromide
pharmaceutical intermediate
2-Amino-6-chloropurine(CAS 10310-21-1)의 국제 HS 코드는 2933.59입니다.
2933.59
2933 59 95
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
6-chloro-7H-purin-2-amine
RYYIULNRIVUMTQ-UHFFFAOYSA-N
C1=NC2=C(N1)C(=NC(=N2)N)Cl
2-Amino-6-chloropurine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.