This compound is a deuterium-labeled derivative of triclosan, used as an isotope-labeled analytical reference standard. Its structure incorporates three deuterium atoms on the dichlorophenyl ring, enabling precise tracking and quantification in analytical chemistry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
5-chloro-2-(2,4-dichloro-3,5,6-trideuteriophenoxy)phenol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Chlorobenzamide-2,3,5,6-d4
isotope-labeled analytical reference standard
Acetylsalicylic Acid-d4
isotope-labeled analytical reference standard
2-NP-AHD-13C3
isotope-labeled analytical reference standard
Triclosan Methyl-d3 Ether
deuterated analytical reference standard
1-Bromo-2-nitrobenze-d4
research reagent
5-(DIPHENYLPHOSPHINO)-1',3',5'-TRIPHENYL-1'H-1,4'-BIPYRAZOLE
Research reagent for catalysis
(3-Bromophenyl)diphenylphosphine oxide
research compound
트리클로산
antiseptic and disinfectant agent
5-chloro-2-(2,4-dichloro-3,5,6-trideuteriophenoxy)phenol
XEFQLINVKFYRCS-UXHGNOADSA-N
[2H]C1=C(C(=C(C(=C1OC2=C(C=C(C=C2)Cl)O)Cl)[2H])Cl)[2H]
5-chloro-2-(2,4-dichloro-3,5,6-trideuteriophenoxy)phenol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.