3-(Trifluoromethoxy)benzoic acid is a chemical compound featuring a benzoic acid core with a trifluoromethoxy substituent. It is primarily used as an intermediate in the synthesis of active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1014-81-9
6-Chloro-5-nitro-1H-indazole
Pharmaceutical intermediate
Tert-butyl (3S)-3-hydroxypyrrolidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
5-Chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid
pharmaceutical intermediate
Hydroxy Dimetridazole-d3
Pharmaceutical intermediate and reference standard
3-(trifluoromethoxy)benzoic acid
OKPFIWIMBJNFSE-UHFFFAOYSA-N
C1=CC(=CC(=C1)OC(F)(F)F)C(=O)O