This compound is a potassium salt of a trifluoroborate-substituted pyrazole, typically used as a chemical research reagent. It features an aromatic heterocycle with a borate group and exists as a salt-like form.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1013640-87-3
4-Hydroxycoumarin
Chemical research reagent
2,4,5-Trifluoro-3-hydroxybenzoic acid
Chemical research reagent
1H-indazole-6-carbonitrile
Chemical research reagent
4-Methoxyphenylhydrazine hydrochloride
Chemical research reagent
2-bromo-5-chlorothiophene-3-carbaldehyde
research compound
Sudan III-d6
Deuterated analytical reference standard
1'-Acetoxy Midazolam N2-?-D-glucuronide
reference standard compound
1-Boc-4-PIPERIDONE-2,2,6,6-D4
deuterated research reagent
potassium trifluoro(1H-pyrazol-5-yl)boranuide
QNHYBMZHGRWURK-UHFFFAOYSA-N
[B-](C1=CC=NN1)(F)(F)F.[K+]
—