This compound is an anionic naphthalene sulfonate salt used as a fluorescent probe and assay reagent in biochemical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 100900-07-0
N1-(4-bromophenyl)-1,2-benzenediamine
research compound
2-BENZYLPYRIDINE
inducer of hepatic microsomal cytochrome P450
(6-Phenyldibenzo[b,d]furan-4-yl)boronic acid
Boronic acid building block for synthesis
2-Chloro-5-thiazolecarboxylic acid
research compound for synthetic chemistry
sodium 5-(2-aminoethylamino)naphthalene-1-sulfonate
HGWRACRQRUQQGH-UHFFFAOYSA-M
C1=CC2=C(C=CC=C2S(=O)(=O)[O-])C(=C1)NCCN.[Na+]