Barium nitrate is an inorganic salt composed of barium and nitrate ions. It is a colorless, toxic, and water-soluble solid that burns with a green flame and serves as an oxidizer, making it valuable in pyrotechnics.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 10022-31-8
Europium Nitrate Hexahydrate
rare earth metal intermediate
Bismuth nitrate pentahydrate
synthesis of other bismuth compounds
STRONTIUM NITRATE
oxidizer and colorant in pyrotechnics
Palladium nitrate
Catalyst for chemical reactions
Guanidinium bicarbonate
carbonate salt of guanidine
Platinum dichloride
catalyst for oxidative chlorination of alkanes
SULFUR MONOCHLORIDE
vulcanizing rubber and chemical synthesis
Tin dichloride dihydrate
Reducing agent and tin-plating electrolyte
barium(2+) dinitrate
IWOUKMZUPDVPGQ-UHFFFAOYSA-N
[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Ba+2]