(Naphthalen-1-yl-d7)boronic acid is a deuterated research compound used primarily as a laboratory reagent. Its structure consists of a naphthalene ring system with a boronic acid group, where seven hydrogen atoms are replaced by deuterium, making it useful for isotope-labeling studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1000869-26-0
1-((R)-3-Amino-pyrrolidin-1-yl)-ethanone
chiral research compound
(2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid
N6-acyl-L-lysine research compound
PIPES monosodium salt
biological buffer
3-Methyl-5-(trifluoromethyl)pyrazole
pharmaceutical research intermediate
1-Naphthaleneboronic acid
Boronic acid research compound
(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)boronic acid
HUMMCEUVDBVXTQ-GSNKEKJESA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])[2H])B(O)O)[2H])[2H]
—