Fructosylvaline is a small-molecule research compound belonging to the class of fructosamines, formed through the non-enzymatic glycation of the amino acid valine with fructose. It is primarily used as a standard or reference material in studies investigating the Maillard reaction and advanced glycation end-products (AGEs) in food chemistry and biomedical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Fructosylvaline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Fluoro-2-nitrobenzoic acid
research compound
3,5-dibromo-2-fluoro-4-methylpyridine
research compound
3-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine
Research reagent
1,4-Piperazinediethanesulfonic acid sesquisodium salt
buffering agent in biochemistry
(2S)-3-methyl-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]butanoic acid
JEQHVKBNRPNQDY-UTINFBMNSA-N
CC(C)[C@@H](C(=O)O)NCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O
Fructosylvaline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.