Pyridine-3,5-dicarboxylic acid is a dicarboxylic acid derivative of pyridine. Its structure features two carboxylic acid groups and an aromatic heterocyclic ring, making it a useful ligand for coordination chemistry research.
Portée du contenu: Les informations de cette page concernent l'identification chimique ainsi que les contextes d'approvisionnement industriel, de recherche et de production. Elles ne constituent ni une allégation thérapeutique, ni un avis médical, ni une notice d'utilisation médicamenteuse.
Approvisionnement ou fourniture de ce composé?
Publiez votre inventaire ou une demande d'achat
CAS 499-81-0
5-Hydroxynicotinic acid
Research reagent
2,9-DIBROMO-1,10-PHENANTHROLINE
research compound for coordination chemistry
2,2'-Bipyridine-4,4'-dicarboxylic acid
research compound for coordination chemistry
Carbonylchlorohydrotris(triphenylphosphine)ruthenium
research compound for coordination chemistry
Guanidine hydrochloride
Laboratory chemical research reagent
Coumalic acid
research compound
3,5-Dimethoxyphenol
chemical standard and research compound
2-Bromo-2'-chloroacetophenone
chemical synthesis intermediate
pyridine-3,5-dicarboxylic acid
MPFLRYZEEAQMLQ-UHFFFAOYSA-N
C1=C(C=NC=C1C(=O)O)C(=O)O