(R)-Indoline-2-carboxylic acid is a chiral compound that serves as a pharmaceutical intermediate. It is primarily used in the synthesis of active pharmaceutical ingredients due to its stereochemically defined structure.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 98167-06-7
L-(-)-3-Phenyllactic acid
pharmaceutical intermediate for drug synthesis
L-4-Hydroxyphenylglycine
pharmaceutical intermediate for drug synthesis
3-Bromofuran
pharmaceutical intermediate for drug synthesis
2-Methyl-2-adamantanol
pharmaceutical intermediate for drug synthesis
1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Boc-protected piperidine carboxylic acid intermediate
(4AR,4bS,6aS,7S,9aS,9bS,11aR)-N-(tert-butyl)-4a,6a-dimethyl-2-oxohexadecahydro-1H-indeno[5,4-f]quinoline-7-carboxamide
pharmaceutical intermediate
Ethyl 2,4,5-trifluorobenzoylacetate
Pharmaceutical intermediate for fluoroquinolone antibiotics
Methyl 2-(bromomethyl)-3-nitrobenzoate
pharmaceutical intermediate
(2R)-2,3-dihydro-1H-indole-2-carboxylic acid
QNRXNRGSOJZINA-MRVPVSSYSA-N
C1[C@@H](NC2=CC=CC=C21)C(=O)O