4-Bromobenzenesulfonyl chloride is a chemical compound commonly employed as a reagent in organic synthesis. It features an aromatic ring substituted with both a bromine atom and a sulfonyl chloride group.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 98-58-8
2-Ethylhexyl chloroformate
Reagent for organic synthesis
4-Methoxybenzenesulfonyl chloride
Sulfonyl chloride reagent for synthesis
4-tert-Butylbenzoic acid
alkyd resin modifier and corrosion inhibitor
Piperidinium piperidine-1-carbodithioate
rubber accelerator
CUMENE
Production of phenol and acetone
4-bromobenzenesulfonyl chloride
KMMHZIBWCXYAAH-UHFFFAOYSA-N
C1=CC(=CC=C1S(=O)(=O)Cl)Br