3-Nitrophthalamide is a chemical compound featuring a benzene ring substituted with two amide groups and a nitro group. It serves as a research chemical intermediate in laboratory and industrial settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 96385-50-1
3-bromo-5-chloroaniline
research compound
4-Nitrophenyl 4,6-ethylidene-a-D-maltoheptaoside
chromogenic substrate for enzyme assays
3-(3,6-Bis(2-hydroxyethyl)pyrazin-2-yl)propanoic acid
research compound
3-Methoxy-4-hydroxyphenylethylamine hydrochloride
research compound
3-nitrobenzene-1,2-dicarboxamide
GMOAOEGBMSRFFQ-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)N)C(=O)N