This compound is a salt-like research reagent consisting of a boroxine derivative coordinated with pyridine. It is primarily used in boroxine chemistry for laboratory studies and material synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 95010-17-6
L-Serine-d2
isotopically labeled research compound
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
Magnesium bromide 3-methylthiophen-2-ide (1/1/1)
research reagent for synthesis
pyridine;2,4,6-tris(ethenyl)-1,3,5,2,4,6-trioxatriborinane
YLHJACXHRQQNQR-UHFFFAOYSA-N
B1(OB(OB(O1)C=C)C=C)C=C.C1=CC=NC=C1