2,3,4,5-Tetrafluorobenzoyl chloride is a fluorinated aromatic acyl chloride used as a pharmaceutical intermediate. It serves as a building block in the synthesis of active pharmaceutical ingredients due to its reactive carbonyl chloride group and multiple fluorine substituents.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 94695-48-4
Ethyl 3-oxo-(2,3,4,5-tetrafluorophenyl)propanoate
Pharmaceutical intermediate for synthesis
2,2-Diphenylacetaldehyde
pharmaceutical intermediate synthesis
Tert-Butyl trans-4-ethynylcyclohexylcarbamate
Pharmaceutical intermediate
N-a-Fmoc-a-aminoisobutyric acid, N-fmoc-c-a-methylalanine
peptide synthesis building block
2,3,4,5-tetrafluorobenzoyl chloride
XWCKIXLTBNGIHV-UHFFFAOYSA-N
C1=C(C(=C(C(=C1F)F)F)F)C(=O)Cl