(2S)-4-azido-2-aminobutyric acid hydrochloride is a research reagent used in chemical biology. It is a salt form of an azido-containing amino acid derivative, featuring an amine and a carboxylic acid group, and is typically employed in laboratory studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 942518-29-8
Bis(2,5-dioxopyrrolidin-1-yl) 9-(azidomethyl)heptadecanedioate
Research reagent for chemical biology
2-Amino-5-bromo-4-chloroPyridine
Laboratory research chemical intermediate
3-Ethynylimidazo[1,2-b]pyridazine
research compound
5,6-Dibromo-1,3-dihydro-2H-inden-2-one
Research reagent
(4-(Di([1,1'-biphenyl]-4-yl)amino)phenyl)boronic acid
research compound
(2S)-2-amino-4-azidobutanoic acid;hydrochloride
MHHYJRIDKLZZEO-DFWYDOINSA-N
C(CN=[N+]=[N-])[C@@H](C(=O)O)N.Cl