Ethyl 4-(butylamino)benzoate is a chemical compound used as a pharmaceutical intermediate. It features an aromatic ring with an ester and an amine functional group, making it suitable for incorporation into more complex drug molecules during synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 94-32-6
5-Chlorobenzotriazole
peptide coupling reagent intermediate
2-Amino-N-(2-(2-chlorobenzoyl)-4-nitrophenyl)acetamide hydrochloride
Pharmaceutical intermediate
(R)-2-(4-Hydroxyphenoxy)propanoic acid
Pharmaceutical intermediate for herbicide synthesis
(2S,3aS,7aS)-Benzyl octahydro-1H-indole-2-carboxylate 4-methylbenzenesulfonate
Perindopril intermediate
ethyl 4-(butylamino)benzoate
GTXRSQYDLPYYNW-UHFFFAOYSA-N
CCCCNC1=CC=C(C=C1)C(=O)OCC