3,4-Dimethoxybenzoic acid is a chemical compound used as an intermediate in pharmaceutical manufacturing. It features a benzoic acid core substituted with two methoxy groups, contributing to its role in the synthesis of various active pharmaceutical ingredients.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 93-07-2
Homoveratric acid
Pharmaceutical intermediate research compound
(r)-4-propylpyrrolidin-2-one
pharmaceutical intermediate
3-(2-chloroethyl)-2-methyl-4H,6H,7H,8H,9H-pyrido[1,2-a]pyrimidin-4-one hydrochloride
pharmaceutical intermediate
1-Benzyl 4-tert-butyl (2R)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate
pharmaceutical intermediate
3,4-dimethoxybenzoic acid
DAUAQNGYDSHRET-UHFFFAOYSA-N
COC1=C(C=C(C=C1)C(=O)O)OC