This compound is a polyfunctional quinazoline derivative characterized by four aromatic rings, multiple ether and amine groups, and a high polar surface area, reflecting its role as a pharmaceutical intermediate. Its structure is built around two substituted quinazoline-2,4-diamine cores linked by a propylamine chain, indicating use in complex organic synthesis for drug development.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 928780-95-4
3-Bromo-6-chloropyridine-2-carboxylic acid
pharmaceutical intermediate
6-Benzyloxypyridine-3-boronic acid
Pharmaceutical intermediate for boronic acid synthesis
Rac N-Benzyl Nebivolol
Pharmaceutical intermediate
Maxacalcitol Impurity 8
Pharmaceutical impurity reference standard
2-N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]propyl]-6,7-dimethoxyquinazoline-2,4-diamine
CEKUOLRGTZEHMC-UHFFFAOYSA-N
CN(CCCNC1=NC2=CC(=C(C=C2C(=N1)N)OC)OC)C3=NC4=CC(=C(C=C4C(=N3)N)OC)OC