(S)-4-Benzyl-2-oxazolidinone is a chiral auxiliary reagent used in stereoselective organic synthesis. It is temporarily incorporated into a molecule to control the stereochemical outcome of subsequent reactions and can typically be recovered after use.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 90719-32-7
3-(((3-(4-Methoxyphenoxy)propyl)amino)methyl)phenol
research compound
Ethyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate
research compound
2-chloro-5-nitroisonicotinic acid
research chemical
3-methyl-1H-indazol-5-amine
research compound
(R)-4-Benzyl-2-oxazolidinone
chiral auxiliary for asymmetric synthesis
(S)-4-(4-aminobenzyl)oxazolidin-2-one
Pharmaceutical intermediate for oxazolidinone synthesis
(4S)-4-Benzyl-3-isovaleryloxazolidin-2-one
pharmaceutical intermediate
(4S)-4-benzyl-1,3-oxazolidin-2-one
OJOFMLDBXPDXLQ-VIFPVBQESA-N
C1[C@@H](NC(=O)O1)CC2=CC=CC=C2