4-(Methylsulfonyl)phenylacetic acid is a chemical compound used as a pharmaceutical intermediate. Its structure includes a phenyl ring substituted with a methylsulfonyl group and an acetic acid moiety, as characterized by crystallographic analysis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 90536-66-6
2-(4-aminophenyl)-1lambda6,2-thiazolidine-1,1-dione
Pharmaceutical intermediate for impurity synthesis
N-(Methylsulfonyl)-4-(desnitro) Nimesulide
Pharmaceutical reference standard impurity
(2S)-2-{[(tert-butoxy)carbonyl]amino}pent-4-enoic acid
Boc-protected amino acid intermediate
1-benzhydrylazetidin-3-ol Hydrochloride
pharmaceutical intermediate
2-(4-methylsulfonylphenyl)acetic acid
HGGWOSYNRVOQJH-UHFFFAOYSA-N
CS(=O)(=O)C1=CC=C(C=C1)CC(=O)O