This compound is a polymeric-type industrial chemical with a large, flexible molecular structure. Its complex architecture features multiple aromatic rings, amine groups, and ester linkages, which contribute to its high molecular weight and hydrophobic character.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 886463-10-1
1,1-bis(acryloyloxymethyl)ethyl isocyanate
crosslinking agent monomer
Dimethyl 2,5-Dioxahexanedioate
intermediate for polyester synthesis
PPG-2 methyl ether acetate
solvent in coatings and inks
3,3,3-trifluoro-2,2-dimethylpropanoic acid
chemical intermediate for synthesis
2-[3-[4-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]piperazin-1-yl]propanoyloxy]ethyl 3-[4-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]piperazin-1-yl]propanoate
XYNGFZCNHCODJJ-UHFFFAOYSA-N
CCC(CC1=CC=CC=C1)(C(=O)C2=CC=C(C=C2)N3CCN(CC3)CCC(=O)OCCOC(=O)CCN4CCN(CC4)C5=CC=C(C=C5)C(=O)C(CC)(CC6=CC=CC=C6)N(C)C)N(C)C