2-(1H-indol-5-yl)benzoic acid is an indole-containing aromatic carboxylic acid used as a research compound. It features both a benzoic acid moiety and an indole ring system, contributing to its structural properties for laboratory investigations.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 886363-17-3
5-Bromo-4-methylpyridine-2-carbonitrile
research reagent
5-Bromo-4-methylpyridine-2-carboxylic acid
research compound
2-(2-(1h-indol-5-yl)phenyl)acetic acid
research compound
3-(1H-indol-5-yl)benzoic Acid
Research compound
4-(1H-indol-5-yl)benzoic Acid
research compound
2-(4-(1h-indol-5-yl)phenyl)acetic acid
pharmaceutical intermediate
2-(1H-indol-5-yl)benzoic acid
PKGXRKSYWVXMKT-UHFFFAOYSA-N
C1=CC=C(C(=C1)C2=CC3=C(C=C2)NC=C3)C(=O)O