6-Bromo-1H-indazole-4-carboxylic acid is a brominated indazole derivative used primarily as a research compound. It features a carboxylic acid functional group and an aromatic heterocyclic ring system, making it valuable for laboratory and synthetic chemistry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 885523-08-0
4,4,5,5-tetramethyl-2-(3-methylthiophen-2-yl)-1,3,2-dioxaborolane
boronic ester for organic synthesis
1-acetyl-4-bromo-1H-indazole
research compound
C-FMS inhibitor
c-FMS kinase inhibitor research compound
6-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)hexanoic acid
Fmoc-protected amino acid reagent
6-bromo-1H-indazole-4-carboxylic acid
YYONCBWTWPVWRT-UHFFFAOYSA-N
C1=C(C=C2C(=C1C(=O)O)C=NN2)Br
—