2-Chloro-3-nitropyrazine is a research compound with a heterocyclic aromatic structure. It is characterized by the presence of a chlorine atom and a nitro group attached to a pyrazine ring, making it a reagent of interest in organic synthesis and pharmaceutical research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 87885-43-6
Pentafluorophenylmagnesium bromide
Grignard reagent for organic synthesis
(2R,3R,4R,5R,6R)-5-Acetamido-2-(acetoxymethyl)-6-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethoxy)tetrahydro-2H-pyran-3,4-diyl diacetate
chemical probe for glycobiology
((2R,3S,4R,5R,6S)-4-(Benzyloxy)-5-(((benzyloxy)carbonyl)amino)-3-hydroxy-6-methoxytetrahydro-2H-pyran-2-yl)methyl benzoate
protected sugar building block
2-(2-chloro-5-nitrophenyl)pyridine
research compound
2-chloro-3-nitropyrazine
WFJAKBGXNXBMLL-UHFFFAOYSA-N
C1=CN=C(C(=N1)[N+](=O)[O-])Cl