2-Pyridinamine-d4 is a deuterated form of 2-aminopyridine where all four hydrogen atoms on the pyridine ring are replaced with deuterium. It is primarily used as an internal standard or labeled reagent in analytical chemistry, particularly for mass spectrometry and nuclear magnetic resonance spectroscopy.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 87802-54-8
L-Leucine-5,5,5-d3
Deuterated amino acid research reagent
Piperidine-4-sulfonic acid amide
research compound
1-cyclopropyl-4-isothiocyanatonaphthalene
research compound
Methyl 2-((5-amino-4-(4-cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazol-3-yl)thio)acetate
Research compound
2-Aminopyridine-d6 naphthol
deuterated research compound
2-Aminopyridin
pharmaceutical intermediate for antihistamines and other drugs
3,4,5,6-tetradeuteriopyridin-2-amine
ICSNLGPSRYBMBD-RHQRLBAQSA-N
[2H]C1=C(C(=NC(=C1[2H])N)[2H])[2H]